C8H14BrO2- — CID 22669337
2-(bromomethyl)-2,3,3-trimethylbutanoate (PubChem CID 22669337) has the molecular formula C8H14BrO2- and a molecular weight of 222.10 g/mol. Its IUPAC name is 2-(bromomethyl)-2,3,3-trimethylbutanoate.
| Compound Name | 2-(bromomethyl)-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 22669337 |
| Molecular Formula | C8H14BrO2- |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2-(bromomethyl)-2,3,3-trimethylbutanoate |
| SMILES | CC(C)(C)C(C)(CBr)C(=O)[O-] |
| InChI | InChI=1S/C8H15BrO2/c1-7(2,3)8(4,5-9)6(10)11/h5H2,1-4H3,(H,10,11)/p-1 |
| InChIKey | OFBBEPKJOPNFAI-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|