C18H29NO4SSi — CID 22670494
tert-butyl 2-oxo-4-thiophen-3-yl-3-triethylsilyloxyazetidine-1-carboxylate (PubChem CID 22670494) has the molecular formula C18H29NO4SSi and a molecular weight of 383.59 g/mol. Its IUPAC name is tert-butyl 2-oxo-4-thiophen-3-yl-3-triethylsilyloxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 2-oxo-4-thiophen-3-yl-3-triethylsilyloxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 22670494 |
| Molecular Formula | C18H29NO4SSi |
| Molecular Weight | 383.59 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl 2-oxo-4-thiophen-3-yl-3-triethylsilyloxyazetidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OC1C(=O)N(C(=O)OC(C)(C)C)C1c1ccsc1 |
| InChI | InChI=1S/C18H29NO4SSi/c1-7-25(8-2,9-3)23-15-14(13-10-11-24-12-13)19(16(15)20)17(21)22-18(4,5)6/h10-12,14-15H,7-9H2,1-6H3 |
| InChIKey | RNGFQGCVBOSBIQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|