C11H14O3S — CID 11413495
tert-butyl (2S,3S)-3-thiophen-3-yloxirane-2-carboxylate (PubChem CID 11413495) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-thiophen-3-yloxirane-2-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-thiophen-3-yloxirane-2-carboxylate |
|---|---|
| PubChem CID | 11413495 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | tert-butyl (2S,3S)-3-thiophen-3-yloxirane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1O[C@H]1c1ccsc1 |
| InChI | InChI=1S/C11H14O3S/c1-11(2,3)14-10(12)9-8(13-9)7-4-5-15-6-7/h4-6,8-9H,1-3H3/t8-,9-/m0/s1 |
| InChIKey | JLMXKKFNEIGGAM-IUCAKERBSA-N |
| XLogP | 2.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|