C22H21ClN2O — CID 2267368
2-[[1-(4-chloroanilino)-2,2-diphenylethenyl]amino]ethanol (PubChem CID 2267368) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-[[1-(4-chloroanilino)-2,2-diphenylethenyl]amino]ethanol.
| Compound Name | 2-[[1-(4-chloroanilino)-2,2-diphenylethenyl]amino]ethanol |
|---|---|
| PubChem CID | 2267368 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[[1-(4-chloroanilino)-2,2-diphenylethenyl]amino]ethanol |
| SMILES | OCCNC(Nc1ccc(Cl)cc1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21ClN2O/c23-19-11-13-20(14-12-19)25-22(24-15-16-26)21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,24-26H,15-16H2 |
| InChIKey | SNGWUMDVWCKFTI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |