C19H18ClN3O4S2 — CID 22674072
N-(1-chloroisoquinolin-6-yl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 22674072) has the molecular formula C19H18ClN3O4S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is N-(1-chloroisoquinolin-6-yl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(1-chloroisoquinolin-6-yl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 22674072 |
| Molecular Formula | C19H18ClN3O4S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N-(1-chloroisoquinolin-6-yl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(Cl)nccc2c1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H18ClN3O4S2/c20-19-18-8-3-15(13-14(18)9-10-21-19)22-28(24,25)16-4-6-17(7-5-16)29(26,27)23-11-1-2-12-23/h3-10,13,22H,1-2,11-12H2 |
| InChIKey | YKJJPESFNHWVKH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|