C14H11N4O3S2- — CID 22674399
N-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate (PubChem CID 22674399) has the molecular formula C14H11N4O3S2- and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate.
| Compound Name | N-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 22674399 |
| Molecular Formula | C14H11N4O3S2- |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate |
| SMILES | O=C([O-])NCCNc1nc(C(=O)c2cccs2)c2sccc2n1 |
| InChI | InChI=1S/C14H12N4O3S2/c19-11(9-2-1-6-22-9)10-12-8(3-7-23-12)17-13(18-10)15-4-5-16-14(20)21/h1-3,6-7,16H,4-5H2,(H,20,21)(H,15,17,18)/p-1 |
| InChIKey | RXMGQNQXRWJEHD-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|