C17H19N5O2S2 — CID 70126675
1-pentyl-3-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]urea (PubChem CID 70126675) has the molecular formula C17H19N5O2S2 and a molecular weight of 389.51 g/mol. Its IUPAC name is 1-pentyl-3-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]urea.
| Compound Name | 1-pentyl-3-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]urea |
|---|---|
| PubChem CID | 70126675 |
| Molecular Formula | C17H19N5O2S2 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-pentyl-3-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]urea |
| SMILES | CCCCCNC(=O)NNc1nc(C(=O)c2cccs2)c2sccc2n1 |
| InChI | InChI=1S/C17H19N5O2S2/c1-2-3-4-8-18-17(24)22-21-16-19-11-7-10-26-15(11)13(20-16)14(23)12-6-5-9-25-12/h5-7,9-10H,2-4,8H2,1H3,(H2,18,22,24)(H,19,20,21) |
| InChIKey | BCYKKWIZALVRMJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|