C20H23N5OS3 — CID 22674490
1-cyclohexyl-3-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]thiourea (PubChem CID 22674490) has the molecular formula C20H23N5OS3 and a molecular weight of 445.64 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]thiourea |
|---|---|
| PubChem CID | 22674490 |
| Molecular Formula | C20H23N5OS3 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 1-cyclohexyl-3-[2-[[4-(thiophene-2-carbonyl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]thiourea |
| SMILES | O=C(c1cccs1)c1nc(NCCNC(=S)NC2CCCCC2)nc2ccsc12 |
| InChI | InChI=1S/C20H23N5OS3/c26-17(15-7-4-11-28-15)16-18-14(8-12-29-18)24-19(25-16)21-9-10-22-20(27)23-13-5-2-1-3-6-13/h4,7-8,11-13H,1-3,5-6,9-10H2,(H,21,24,25)(H2,22,23,27) |
| InChIKey | LIKKGVVZNLGHAR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|