C28H33Cl2N3O2 — CID 22674508
benzyl 6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate;dihydrochloride (PubChem CID 22674508) has the molecular formula C28H33Cl2N3O2 and a molecular weight of 514.50 g/mol. Its IUPAC name is benzyl 6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate;dihydrochloride.
| Compound Name | benzyl 6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 22674508 |
| Molecular Formula | C28H33Cl2N3O2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | benzyl 6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate;dihydrochloride |
| SMILES | Cl.Cl.O=C(OCc1ccccc1)N1CCN2C(CNCC2C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H31N3O2.2ClH/c32-28(33-21-22-10-4-1-5-11-22)30-16-17-31-25(20-30)18-29-19-26(31)27(23-12-6-2-7-13-23)24-14-8-3-9-15-24;;/h1-15,25-27,29H,16-21H2;2*1H |
| InChIKey | LNKKGYWXRQMZPP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |