C20H22N4OS — CID 22675422
N-[6-(1H-benzimidazol-2-ylsulfanyl)hexyl]-1,3-benzoxazol-2-amine (PubChem CID 22675422) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[6-(1H-benzimidazol-2-ylsulfanyl)hexyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[6-(1H-benzimidazol-2-ylsulfanyl)hexyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 22675422 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[6-(1H-benzimidazol-2-ylsulfanyl)hexyl]-1,3-benzoxazol-2-amine |
| SMILES | c1ccc2[nH]c(SCCCCCCNc3nc4ccccc4o3)nc2c1 |
| InChI | InChI=1S/C20H22N4OS/c1(7-13-21-19-22-17-11-5-6-12-18(17)25-19)2-8-14-26-20-23-15-9-3-4-10-16(15)24-20/h3-6,9-12H,1-2,7-8,13-14H2,(H,21,22)(H,23,24) |
| InChIKey | PLPUZIQTCDLRHN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|