C27H30N2O7 — CID 22678751
oxalic acid;3-[[4-[(2-phenylmethoxyphenyl)methoxy]piperidin-1-yl]methyl]-1H-pyridin-2-one (PubChem CID 22678751) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is oxalic acid;3-[[4-[(2-phenylmethoxyphenyl)methoxy]piperidin-1-yl]methyl]-1H-pyridin-2-one.
| Compound Name | oxalic acid;3-[[4-[(2-phenylmethoxyphenyl)methoxy]piperidin-1-yl]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 22678751 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | oxalic acid;3-[[4-[(2-phenylmethoxyphenyl)methoxy]piperidin-1-yl]methyl]-1H-pyridin-2-one |
| SMILES | O=C(O)C(=O)O.O=c1[nH]cccc1CN1CCC(OCc2ccccc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N2O3.C2H2O4/c28-25-21(10-6-14-26-25)17-27-15-12-23(13-16-27)29-19-22-9-4-5-11-24(22)30-18-20-7-2-1-3-8-20;3-1(4)2(5)6/h1-11,14,23H,12-13,15-19H2,(H,26,28);(H,3,4)(H,5,6) |
| InChIKey | ANLQHSIXANHYSX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|