C28H38N2O6 — CID 22678381
3-[[4-[[2-(1-cyclohexylethyl)phenoxy]methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one;oxalic acid (PubChem CID 22678381) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is 3-[[4-[[2-(1-cyclohexylethyl)phenoxy]methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one;oxalic acid.
| Compound Name | 3-[[4-[[2-(1-cyclohexylethyl)phenoxy]methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one;oxalic acid |
|---|---|
| PubChem CID | 22678381 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 3-[[4-[[2-(1-cyclohexylethyl)phenoxy]methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one;oxalic acid |
| SMILES | CC(c1ccccc1OCC1CCN(Cc2ccc[nH]c2=O)CC1)C1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H36N2O2.C2H2O4/c1-20(22-8-3-2-4-9-22)24-11-5-6-12-25(24)30-19-21-13-16-28(17-14-21)18-23-10-7-15-27-26(23)29;3-1(4)2(5)6/h5-7,10-12,15,20-22H,2-4,8-9,13-14,16-19H2,1H3,(H,27,29);(H,3,4)(H,5,6) |
| InChIKey | BZVFTQIWXYCFKV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|