C15H14N2O4 — CID 2268422
5-(2-methyl-4-nitrophenyl)-N-prop-2-enylfuran-2-carboxamide (PubChem CID 2268422) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-(2-methyl-4-nitrophenyl)-N-prop-2-enylfuran-2-carboxamide.
| Compound Name | 5-(2-methyl-4-nitrophenyl)-N-prop-2-enylfuran-2-carboxamide |
|---|---|
| PubChem CID | 2268422 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-(2-methyl-4-nitrophenyl)-N-prop-2-enylfuran-2-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2C)o1 |
| InChI | InChI=1S/C15H14N2O4/c1-3-8-16-15(18)14-7-6-13(21-14)12-5-4-11(17(19)20)9-10(12)2/h3-7,9H,1,8H2,2H3,(H,16,18) |
| InChIKey | SUSDBOGRXMVHLZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|