C15H20N2O3S — CID 22690197
(2S,4aR,7aS)-4-(3,4-dimethylphenyl)-2-methyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one (PubChem CID 22690197) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (2S,4aR,7aS)-4-(3,4-dimethylphenyl)-2-methyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one.
| Compound Name | (2S,4aR,7aS)-4-(3,4-dimethylphenyl)-2-methyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 22690197 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2S,4aR,7aS)-4-(3,4-dimethylphenyl)-2-methyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
| SMILES | Cc1ccc(N2C(=O)[C@H](C)N[C@@H]3CS(=O)(=O)C[C@@H]32)cc1C |
| InChI | InChI=1S/C15H20N2O3S/c1-9-4-5-12(6-10(9)2)17-14-8-21(19,20)7-13(14)16-11(3)15(17)18/h4-6,11,13-14,16H,7-8H2,1-3H3/t11-,13+,14-/m0/s1 |
| InChIKey | KVKOJKZRUAOIAZ-YUTCNCBUSA-N |
| XLogP | 0.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |