C14H13ClN4S — CID 22693040
N-(2-chloroquinazolin-4-yl)-4-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 22693040) has the molecular formula C14H13ClN4S and a molecular weight of 304.81 g/mol. Its IUPAC name is N-(2-chloroquinazolin-4-yl)-4-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloroquinazolin-4-yl)-4-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 22693040 |
| Molecular Formula | C14H13ClN4S |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-(2-chloroquinazolin-4-yl)-4-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)c1csc(Nc2nc(Cl)nc3ccccc23)n1 |
| InChI | InChI=1S/C14H13ClN4S/c1-8(2)11-7-20-14(17-11)19-12-9-5-3-4-6-10(9)16-13(15)18-12/h3-8H,1-2H3,(H,16,17,18,19) |
| InChIKey | KYGZOLUEUKBWQV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |