C7H13N5O — CID 22694034
5-[2-(dimethylamino)ethylamino]-2H-1,2,4-triazin-3-one (PubChem CID 22694034) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylamino]-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[2-(dimethylamino)ethylamino]-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 22694034 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 5-[2-(dimethylamino)ethylamino]-2H-1,2,4-triazin-3-one |
| SMILES | CN(C)CCNc1cn[nH]c(=O)n1 |
| InChI | InChI=1S/C7H13N5O/c1-12(2)4-3-8-6-5-9-11-7(13)10-6/h5H,3-4H2,1-2H3,(H2,8,10,11,13) |
| InChIKey | JJWSNEVWBBDGCU-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |