C16H14N2O7S2 — CID 22694994
N-(1,3-benzodioxol-5-yl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide (PubChem CID 22694994) has the molecular formula C16H14N2O7S2 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22694994 |
| Molecular Formula | C16H14N2O7S2 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
| SMILES | O=C1CCS(=O)(=O)N1c1ccc(S(=O)(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H14N2O7S2/c19-16-7-8-26(20,21)18(16)12-2-4-13(5-3-12)27(22,23)17-11-1-6-14-15(9-11)25-10-24-14/h1-6,9,17H,7-8,10H2 |
| InChIKey | KRPBIZHCDDPFCY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|