C15H12ClNO2 — CID 2270278
(3aS,7aR)-1-[(2-chlorophenyl)methyl]-3a,7a-dihydroindole-2,3-dione (PubChem CID 2270278) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is (3aS,7aR)-1-[(2-chlorophenyl)methyl]-3a,7a-dihydroindole-2,3-dione.
| Compound Name | (3aS,7aR)-1-[(2-chlorophenyl)methyl]-3a,7a-dihydroindole-2,3-dione |
|---|---|
| PubChem CID | 2270278 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (3aS,7aR)-1-[(2-chlorophenyl)methyl]-3a,7a-dihydroindole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccccc2Cl)[C@@H]2C=CC=C[C@H]12 |
| InChI | InChI=1S/C15H12ClNO2/c16-12-7-3-1-5-10(12)9-17-13-8-4-2-6-11(13)14(18)15(17)19/h1-8,11,13H,9H2/t11-,13+/m0/s1 |
| InChIKey | CZELHLUNJVEJTA-WCQYABFASA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|