C19H25NO3S2 — CID 22711678
N-benzyl-4-ethoxy-N-(2-methyl-1-sulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 22711678) has the molecular formula C19H25NO3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-benzyl-4-ethoxy-N-(2-methyl-1-sulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | N-benzyl-4-ethoxy-N-(2-methyl-1-sulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22711678 |
| Molecular Formula | C19H25NO3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-benzyl-4-ethoxy-N-(2-methyl-1-sulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(Cc2ccccc2)C(C)(C)CS)cc1 |
| InChI | InChI=1S/C19H25NO3S2/c1-4-23-17-10-12-18(13-11-17)25(21,22)20(19(2,3)15-24)14-16-8-6-5-7-9-16/h5-13,24H,4,14-15H2,1-3H3 |
| InChIKey | YYSOWGNYRAMIHV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|