C24H26N2O7S2 — CID 10311540
2-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxy-2-methylpropanamide (PubChem CID 10311540) has the molecular formula C24H26N2O7S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxy-2-methylpropanamide.
| Compound Name | 2-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 10311540 |
| Molecular Formula | C24H26N2O7S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 2-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxy-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NO)N(Cc1ccccc1)S(=O)(=O)c1ccc(Oc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O7S2/c1-24(2,23(27)25-28)26(17-18-7-5-4-6-8-18)35(31,32)22-15-11-20(12-16-22)33-19-9-13-21(14-10-19)34(3,29)30/h4-16,28H,17H2,1-3H3,(H,25,27) |
| InChIKey | CSRDJKACIAQCPM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|