C26H28N2O8S2 — CID 10289745
4-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxyoxane-4-carboxamide (PubChem CID 10289745) has the molecular formula C26H28N2O8S2 and a molecular weight of 560.65 g/mol. Its IUPAC name is 4-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 10289745 |
| Molecular Formula | C26H28N2O8S2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 4-[benzyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-N-hydroxyoxane-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(S(=O)(=O)N(Cc3ccccc3)C3(C(=O)NO)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O8S2/c1-37(31,32)23-11-7-21(8-12-23)36-22-9-13-24(14-10-22)38(33,34)28(19-20-5-3-2-4-6-20)26(25(29)27-30)15-17-35-18-16-26/h2-14,30H,15-19H2,1H3,(H,27,29) |
| InChIKey | WEQVZBLLDIIAEC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|