C20H23NO6S2 — CID 110166513
4-benzyl-N-(4-methylsulfonylphenyl)sulfonyloxane-4-carboxamide (PubChem CID 110166513) has the molecular formula C20H23NO6S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-benzyl-N-(4-methylsulfonylphenyl)sulfonyloxane-4-carboxamide.
| Compound Name | 4-benzyl-N-(4-methylsulfonylphenyl)sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 110166513 |
| Molecular Formula | C20H23NO6S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-benzyl-N-(4-methylsulfonylphenyl)sulfonyloxane-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NC(=O)C2(Cc3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C20H23NO6S2/c1-28(23,24)17-7-9-18(10-8-17)29(25,26)21-19(22)20(11-13-27-14-12-20)15-16-5-3-2-4-6-16/h2-10H,11-15H2,1H3,(H,21,22) |
| InChIKey | HNENWZHHQMJECD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |