C23H30N2O6S — CID 22907074
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-(oxocan-4-yl)acetamide (PubChem CID 22907074) has the molecular formula C23H30N2O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-(oxocan-4-yl)acetamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-(oxocan-4-yl)acetamide |
|---|---|
| PubChem CID | 22907074 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-(oxocan-4-yl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)C(C(=O)NO)C2CCCCOCC2)cc1 |
| InChI | InChI=1S/C23H30N2O6S/c1-30-20-10-12-21(13-11-20)32(28,29)25(17-18-7-3-2-4-8-18)22(23(26)24-27)19-9-5-6-15-31-16-14-19/h2-4,7-8,10-13,19,22,27H,5-6,9,14-17H2,1H3,(H,24,26) |
| InChIKey | JSPHFCUQUGKFHW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|