C24H33N3O6S — CID 18661071
(2R)-2-(4-ethoxycyclohexyl)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-N-hydroxyacetamide (PubChem CID 18661071) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is (2R)-2-(4-ethoxycyclohexyl)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-N-hydroxyacetamide.
| Compound Name | (2R)-2-(4-ethoxycyclohexyl)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 18661071 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (2R)-2-(4-ethoxycyclohexyl)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-N-hydroxyacetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(Cc2ccncc2)[C@@H](C(=O)NO)C2CCC(OCC)CC2)cc1 |
| InChI | InChI=1S/C24H33N3O6S/c1-3-32-20-7-5-19(6-8-20)23(24(28)26-29)27(17-18-13-15-25-16-14-18)34(30,31)22-11-9-21(10-12-22)33-4-2/h9-16,19-20,23,29H,3-8,17H2,1-2H3,(H,26,28)/t19?,20?,23-/m1/s1 |
| InChIKey | JBBNQXGEGUPQTI-YABDQXBESA-N |
| XLogP | 3.14 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|