C25H35N3O6S — CID 19077684
2-(4-butoxycyclohexyl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]acetamide (PubChem CID 19077684) has the molecular formula C25H35N3O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-(4-butoxycyclohexyl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]acetamide.
| Compound Name | 2-(4-butoxycyclohexyl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 19077684 |
| Molecular Formula | C25H35N3O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-(4-butoxycyclohexyl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]acetamide |
| SMILES | CCCCOC1CCC(C(C(=O)NO)N(Cc2ccncc2)S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H35N3O6S/c1-3-4-17-34-22-7-5-20(6-8-22)24(25(29)27-30)28(18-19-13-15-26-16-14-19)35(31,32)23-11-9-21(33-2)10-12-23/h9-16,20,22,24,30H,3-8,17-18H2,1-2H3,(H,27,29) |
| InChIKey | DFIMOOPRXNFJMN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|