C25H36ClN3O6S — CID 18661099
(2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-2-[4-(2-methylpropoxy)cyclohexyl]acetamide;hydrochloride (PubChem CID 18661099) has the molecular formula C25H36ClN3O6S and a molecular weight of 542.10 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-2-[4-(2-methylpropoxy)cyclohexyl]acetamide;hydrochloride.
| Compound Name | (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-2-[4-(2-methylpropoxy)cyclohexyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 18661099 |
| Molecular Formula | C25H36ClN3O6S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-4-ylmethyl)amino]-2-[4-(2-methylpropoxy)cyclohexyl]acetamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccncc2)[C@@H](C(=O)NO)C2CCC(OCC(C)C)CC2)cc1.Cl |
| InChI | InChI=1S/C25H35N3O6S.ClH/c1-18(2)17-34-22-6-4-20(5-7-22)24(25(29)27-30)28(16-19-12-14-26-15-13-19)35(31,32)23-10-8-21(33-3)9-11-23;/h8-15,18,20,22,24,30H,4-7,16-17H2,1-3H3,(H,27,29);1H/t20?,22?,24-;/m1./s1 |
| InChIKey | RVHMTWLCTXLQFK-UEUFRIPOSA-N |
| XLogP | 3.81 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|