C15H8Cl3N3O2 — CID 22711992
4-chloro-8-(2,4-dichlorophenyl)-2-methyl-5-nitro-1,7-naphthyridine (PubChem CID 22711992) has the molecular formula C15H8Cl3N3O2 and a molecular weight of 368.61 g/mol. Its IUPAC name is 4-chloro-8-(2,4-dichlorophenyl)-2-methyl-5-nitro-1,7-naphthyridine.
| Compound Name | 4-chloro-8-(2,4-dichlorophenyl)-2-methyl-5-nitro-1,7-naphthyridine |
|---|---|
| PubChem CID | 22711992 |
| Molecular Formula | C15H8Cl3N3O2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 4-chloro-8-(2,4-dichlorophenyl)-2-methyl-5-nitro-1,7-naphthyridine |
| SMILES | Cc1cc(Cl)c2c([N+](=O)[O-])cnc(-c3ccc(Cl)cc3Cl)c2n1 |
| InChI | InChI=1S/C15H8Cl3N3O2/c1-7-4-11(18)13-12(21(22)23)6-19-14(15(13)20-7)9-3-2-8(16)5-10(9)17/h2-6H,1H3 |
| InChIKey | PBUNNDITARZMOM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|