About 4-(methylamino)pentanoic acid
4-(methylamino)pentanoic acid (PubChem CID 22714598) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 4-(methylamino)pentanoic acid.
Molecular Properties
| Compound Name | 4-(methylamino)pentanoic acid |
| PubChem CID | 22714598 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 4-(methylamino)pentanoic acid |
| SMILES | CNC(C)CCC(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-5(7-2)3-4-6(8)9/h5,7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | FTNSJGNMQRMLBJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(methylamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)pentanoic acid?
The IUPAC name of 4-(methylamino)pentanoic acid (CID 22714598) is 4-(methylamino)pentanoic acid.
What is the SMILES notation for 4-(methylamino)pentanoic acid?
The canonical SMILES for 4-(methylamino)pentanoic acid is CNC(C)CCC(=O)O.
What is the InChIKey of 4-(methylamino)pentanoic acid?
The InChIKey is FTNSJGNMQRMLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-5(7-2)3-4-6(8)9/h5,7H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 4-(methylamino)pentanoic acid?
4-(methylamino)pentanoic acid has a molecular weight of 131.18 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)pentanoic acid is sourced from PubChem (CID 22714598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).