C17H26FN3O4S — CID 22718347
tert-butyl 4-[2-[(4-fluorophenyl)sulfamoyl]ethyl]piperazine-1-carboxylate (PubChem CID 22718347) has the molecular formula C17H26FN3O4S and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-fluorophenyl)sulfamoyl]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-fluorophenyl)sulfamoyl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22718347 |
| Molecular Formula | C17H26FN3O4S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | tert-butyl 4-[2-[(4-fluorophenyl)sulfamoyl]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCS(=O)(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H26FN3O4S/c1-17(2,3)25-16(22)21-10-8-20(9-11-21)12-13-26(23,24)19-15-6-4-14(18)5-7-15/h4-7,19H,8-13H2,1-3H3 |
| InChIKey | XTQVSPVSTVWKQO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |