About dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane
dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane (PubChem CID 22719275) has the molecular formula C4H11O6PSi-2
and a molecular weight of 214.19 g/mol. Its IUPAC name is dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane.
Molecular Properties
| Compound Name | dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane |
| PubChem CID | 22719275 |
| Molecular Formula | C4H11O6PSi-2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane |
| SMILES | O=P([O-])([O-])CCCC[Si](O)(O)O |
| InChI | InChI=1S/C4H13O6PSi/c5-11(6,7)3-1-2-4-12(8,9)10/h8-10H,1-4H2,(H2,5,6,7)/p-2 |
| InChIKey | FNSCAVNJPDIARO-UHFFFAOYSA-L |
| XLogP | -2.40 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane?
The IUPAC name of dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane (CID 22719275) is dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane.
What is the SMILES notation for dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane?
The canonical SMILES for dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane is O=P([O-])([O-])CCCC[Si](O)(O)O.
What is the InChIKey of dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane?
The InChIKey is FNSCAVNJPDIARO-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H13O6PSi/c5-11(6,7)3-1-2-4-12(8,9)10/h8-10H,1-4H2,(H2,5,6,7)/p-2.
What are the key properties of dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane?
dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane has a molecular weight of 214.19 g/mol, XLogP of -2.40, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido-oxo-(4-trihydroxysilylbutyl)-λ5-phosphane is sourced from PubChem (CID 22719275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).