C5H16O6PSi- — CID 165099951
methane;methyl(3-trihydroxysilylpropoxy)phosphinate (PubChem CID 165099951) has the molecular formula C5H16O6PSi- and a molecular weight of 231.24 g/mol. Its IUPAC name is methane;methyl(3-trihydroxysilylpropoxy)phosphinate.
| Compound Name | methane;methyl(3-trihydroxysilylpropoxy)phosphinate |
|---|---|
| PubChem CID | 165099951 |
| Molecular Formula | C5H16O6PSi- |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | methane;methyl(3-trihydroxysilylpropoxy)phosphinate |
| SMILES | C.CP(=O)([O-])OCCC[Si](O)(O)O |
| InChI | InChI=1S/C4H13O6PSi.CH4/c1-11(5,6)10-3-2-4-12(7,8)9;/h7-9H,2-4H2,1H3,(H,5,6);1H4/p-1 |
| InChIKey | YDTGOLKPWVQJQZ-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|