C14H13N5 — CID 22724070
2-N-[3-(1H-imidazol-5-yl)phenyl]pyridine-2,3-diamine (PubChem CID 22724070) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-N-[3-(1H-imidazol-5-yl)phenyl]pyridine-2,3-diamine.
| Compound Name | 2-N-[3-(1H-imidazol-5-yl)phenyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 22724070 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-N-[3-(1H-imidazol-5-yl)phenyl]pyridine-2,3-diamine |
| SMILES | Nc1cccnc1Nc1cccc(-c2cnc[nH]2)c1 |
| InChI | InChI=1S/C14H13N5/c15-12-5-2-6-17-14(12)19-11-4-1-3-10(7-11)13-8-16-9-18-13/h1-9H,15H2,(H,16,18)(H,17,19) |
| InChIKey | MUPMFLVPFHPXIL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |