C38H43NO4 — CID 22727811
2-ethoxy-3-[4-[2-[methyl-[13-methyl-5-(1-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22727811) has the molecular formula C38H43NO4 and a molecular weight of 577.77 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[methyl-[13-methyl-5-(1-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[methyl-[13-methyl-5-(1-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22727811 |
| Molecular Formula | C38H43NO4 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[methyl-[13-methyl-5-(1-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(C)C2c3ccc(C)cc3CCc3ccc(C(C)c4ccccc4)cc32)cc1)C(=O)O |
| InChI | InChI=1S/C38H43NO4/c1-5-42-36(38(40)41)24-28-12-18-33(19-13-28)43-22-21-39(4)37-34-20-11-26(2)23-32(34)17-15-30-14-16-31(25-35(30)37)27(3)29-9-7-6-8-10-29/h6-14,16,18-20,23,25,27,36-37H,5,15,17,21-22,24H2,1-4H3,(H,40,41) |
| InChIKey | FCGPQWCIKDRWRK-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |