C36H39NO4 — CID 22727676
2-ethoxy-3-[4-[2-[methyl-(6-methyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22727676) has the molecular formula C36H39NO4 and a molecular weight of 549.71 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[methyl-(6-methyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[methyl-(6-methyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22727676 |
| Molecular Formula | C36H39NO4 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[methyl-(6-methyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(C)C2c3ccc(C)cc3CCc3cc(-c4ccccc4)ccc32)cc1)C(=O)O |
| InChI | InChI=1S/C36H39NO4/c1-4-40-34(36(38)39)23-26-11-16-31(17-12-26)41-21-20-37(3)35-32-18-10-25(2)22-29(32)13-14-30-24-28(15-19-33(30)35)27-8-6-5-7-9-27/h5-12,15-19,22,24,34-35H,4,13-14,20-21,23H2,1-3H3,(H,38,39) |
| InChIKey | ZAVMZEUVYBCVQR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |