C36H36O5 — CID 22727708
2-ethoxy-3-[4-[2-[(5-ethyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)oxy]ethoxy]phenyl]propanoic acid (PubChem CID 22727708) has the molecular formula C36H36O5 and a molecular weight of 548.68 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(5-ethyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)oxy]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(5-ethyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)oxy]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22727708 |
| Molecular Formula | C36H36O5 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(5-ethyl-13-phenyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)oxy]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCOC2c3ccc(-c4ccccc4)cc3C=Cc3ccc(CC)cc32)cc1)C(=O)O |
| InChI | InChI=1S/C36H36O5/c1-3-25-10-13-28-14-15-30-24-29(27-8-6-5-7-9-27)16-19-32(30)35(33(28)22-25)41-21-20-40-31-17-11-26(12-18-31)23-34(36(37)38)39-4-2/h5-19,22,24,34-35H,3-4,20-21,23H2,1-2H3,(H,37,38) |
| InChIKey | YXHWPEICLSTERH-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|