C38H40O5 — CID 22727867
2-methoxy-3-[4-[2-[[13-(1-phenylethyl)-5-propyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]oxy]ethoxy]phenyl]propanoic acid (PubChem CID 22727867) has the molecular formula C38H40O5 and a molecular weight of 576.73 g/mol. Its IUPAC name is 2-methoxy-3-[4-[2-[[13-(1-phenylethyl)-5-propyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]oxy]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-methoxy-3-[4-[2-[[13-(1-phenylethyl)-5-propyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]oxy]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22727867 |
| Molecular Formula | C38H40O5 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 2-methoxy-3-[4-[2-[[13-(1-phenylethyl)-5-propyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]oxy]ethoxy]phenyl]propanoic acid |
| SMILES | CCCc1ccc2c(c1)C(OCCOc1ccc(CC(OC)C(=O)O)cc1)c1ccc(C(C)c3ccccc3)cc1C=C2 |
| InChI | InChI=1S/C38H40O5/c1-4-8-27-11-14-30-15-16-32-25-31(26(2)29-9-6-5-7-10-29)17-20-34(32)37(35(30)23-27)43-22-21-42-33-18-12-28(13-19-33)24-36(41-3)38(39)40/h5-7,9-20,23,25-26,36-37H,4,8,21-22,24H2,1-3H3,(H,39,40) |
| InChIKey | VUTAETAGDXQNSS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|