C37H41NO4 — CID 22727690
3-[4-[2-[(6-benzyl-13-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-methylamino]ethoxy]phenyl]-2-methoxypropanoic acid (PubChem CID 22727690) has the molecular formula C37H41NO4 and a molecular weight of 563.74 g/mol. Its IUPAC name is 3-[4-[2-[(6-benzyl-13-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-methylamino]ethoxy]phenyl]-2-methoxypropanoic acid.
| Compound Name | 3-[4-[2-[(6-benzyl-13-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-methylamino]ethoxy]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 22727690 |
| Molecular Formula | C37H41NO4 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | 3-[4-[2-[(6-benzyl-13-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-methylamino]ethoxy]phenyl]-2-methoxypropanoic acid |
| SMILES | CCc1ccc2c(c1)CCc1cc(Cc3ccccc3)ccc1C2N(C)CCOc1ccc(CC(OC)C(=O)O)cc1 |
| InChI | InChI=1S/C37H41NO4/c1-4-26-12-18-33-30(23-26)14-15-31-24-29(22-27-8-6-5-7-9-27)13-19-34(31)36(33)38(2)20-21-42-32-16-10-28(11-17-32)25-35(41-3)37(39)40/h5-13,16-19,23-24,35-36H,4,14-15,20-22,25H2,1-3H3,(H,39,40) |
| InChIKey | YZSOTYIDBPDJTC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |