C19H26FNO2S — CID 22728193
2-amino-4-[3-fluoro-5-(4-phenoxybutyl)thiophen-2-yl]-2-methylbutan-1-ol (PubChem CID 22728193) has the molecular formula C19H26FNO2S and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-amino-4-[3-fluoro-5-(4-phenoxybutyl)thiophen-2-yl]-2-methylbutan-1-ol.
| Compound Name | 2-amino-4-[3-fluoro-5-(4-phenoxybutyl)thiophen-2-yl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 22728193 |
| Molecular Formula | C19H26FNO2S |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-amino-4-[3-fluoro-5-(4-phenoxybutyl)thiophen-2-yl]-2-methylbutan-1-ol |
| SMILES | CC(N)(CO)CCc1sc(CCCCOc2ccccc2)cc1F |
| InChI | InChI=1S/C19H26FNO2S/c1-19(21,14-22)11-10-18-17(20)13-16(24-18)9-5-6-12-23-15-7-3-2-4-8-15/h2-4,7-8,13,22H,5-6,9-12,14,21H2,1H3 |
| InChIKey | ANNLZXKRIFJOQO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|