C19H20N4O3 — CID 22728601
3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-morpholin-4-ylpyrrole-2,5-dione (PubChem CID 22728601) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-morpholin-4-ylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-morpholin-4-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 22728601 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-morpholin-4-ylpyrrole-2,5-dione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C1=C(N2CCOCC2)C(=O)NC1=O |
| InChI | InChI=1S/C19H20N4O3/c1-12-15(13(2)23(21-12)14-6-4-3-5-7-14)16-17(19(25)20-18(16)24)22-8-10-26-11-9-22/h3-7H,8-11H2,1-2H3,(H,20,24,25) |
| InChIKey | UHHHKULDTKQOBL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|