C34H32F2N2O2 — CID 22728683
4-[3-(3,5-difluorophenyl)-3-(4-piperidin-1-ylphenyl)benzo[f]chromen-6-yl]morpholine (PubChem CID 22728683) has the molecular formula C34H32F2N2O2 and a molecular weight of 538.64 g/mol. Its IUPAC name is 4-[3-(3,5-difluorophenyl)-3-(4-piperidin-1-ylphenyl)benzo[f]chromen-6-yl]morpholine.
| Compound Name | 4-[3-(3,5-difluorophenyl)-3-(4-piperidin-1-ylphenyl)benzo[f]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 22728683 |
| Molecular Formula | C34H32F2N2O2 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 4-[3-(3,5-difluorophenyl)-3-(4-piperidin-1-ylphenyl)benzo[f]chromen-6-yl]morpholine |
| SMILES | Fc1cc(F)cc(C2(c3ccc(N4CCCCC4)cc3)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)c1 |
| InChI | InChI=1S/C34H32F2N2O2/c35-26-20-25(21-27(36)22-26)34(24-8-10-28(11-9-24)37-14-4-1-5-15-37)13-12-31-29-6-2-3-7-30(29)32(23-33(31)40-34)38-16-18-39-19-17-38/h2-3,6-13,20-23H,1,4-5,14-19H2 |
| InChIKey | CRDQVQWUHPXYBJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|