C21H22N3O4S+ — CID 2273424
1,3-benzodioxol-5-ylmethyl-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-(ethylamino)methylidene]azanium (PubChem CID 2273424) has the molecular formula C21H22N3O4S+ and a molecular weight of 412.49 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-(ethylamino)methylidene]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-(ethylamino)methylidene]azanium |
|---|---|
| PubChem CID | 2273424 |
| Molecular Formula | C21H22N3O4S+ |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-(ethylamino)methylidene]azanium |
| SMILES | CCN/C(=[NH+]\Cc1ccc2c(c1)OCO2)S[C@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H21N3O4S/c1-2-22-21(23-12-14-8-9-16-17(10-14)28-13-27-16)29-18-11-19(25)24(20(18)26)15-6-4-3-5-7-15/h3-10,18H,2,11-13H2,1H3,(H,22,23)/p+1/t18-/m0/s1 |
| InChIKey | BIQQLHIKOGCXDL-SFHVURJKSA-O |
| XLogP | 1.03 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|