C24H34O6 — CID 22737298
4-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypent-1-en-2-yl)oxypropoxy]-2,2-dimethylpent-4-enoic acid (PubChem CID 22737298) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is 4-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypent-1-en-2-yl)oxypropoxy]-2,2-dimethylpent-4-enoic acid.
| Compound Name | 4-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypent-1-en-2-yl)oxypropoxy]-2,2-dimethylpent-4-enoic acid |
|---|---|
| PubChem CID | 22737298 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypent-1-en-2-yl)oxypropoxy]-2,2-dimethylpent-4-enoic acid |
| SMILES | C=C(CC(C)(C)C(=O)O)OCCCOC(=C)CC(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H34O6/c1-18(15-23(3,4)21(25)26)28-13-10-14-29-19(2)16-24(5,6)22(27)30-17-20-11-8-7-9-12-20/h7-9,11-12H,1-2,10,13-17H2,3-6H3,(H,25,26) |
| InChIKey | KACOGLUYEHICEI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|