C25H35N3O4S — CID 22741765
(4-benzylpiperidin-4-yl)-(4-methylpiperazin-1-yl)methanone;4-methylbenzenesulfonic acid (PubChem CID 22741765) has the molecular formula C25H35N3O4S and a molecular weight of 473.64 g/mol. Its IUPAC name is (4-benzylpiperidin-4-yl)-(4-methylpiperazin-1-yl)methanone;4-methylbenzenesulfonic acid.
| Compound Name | (4-benzylpiperidin-4-yl)-(4-methylpiperazin-1-yl)methanone;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 22741765 |
| Molecular Formula | C25H35N3O4S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (4-benzylpiperidin-4-yl)-(4-methylpiperazin-1-yl)methanone;4-methylbenzenesulfonic acid |
| SMILES | CN1CCN(C(=O)C2(Cc3ccccc3)CCNCC2)CC1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H27N3O.C7H8O3S/c1-20-11-13-21(14-12-20)17(22)18(7-9-19-10-8-18)15-16-5-3-2-4-6-16;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,19H,7-15H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | BPHAGBUCTZIYJL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|