C16H27NOSi — CID 22743375
2,6-di(propan-2-yl)-N-trimethylsilylbenzamide (PubChem CID 22743375) has the molecular formula C16H27NOSi and a molecular weight of 277.48 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-N-trimethylsilylbenzamide.
| Compound Name | 2,6-di(propan-2-yl)-N-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 22743375 |
| Molecular Formula | C16H27NOSi |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2,6-di(propan-2-yl)-N-trimethylsilylbenzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1C(=O)N[Si](C)(C)C |
| InChI | InChI=1S/C16H27NOSi/c1-11(2)13-9-8-10-14(12(3)4)15(13)16(18)17-19(5,6)7/h8-12H,1-7H3,(H,17,18) |
| InChIKey | FVKUWRUJRVZCEY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|