C25H26N2O3S — CID 22750888
1,1-diphenyl-3-[(E)-2-(4-propan-2-ylphenyl)prop-1-enyl]sulfonylurea (PubChem CID 22750888) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1,1-diphenyl-3-[(E)-2-(4-propan-2-ylphenyl)prop-1-enyl]sulfonylurea.
| Compound Name | 1,1-diphenyl-3-[(E)-2-(4-propan-2-ylphenyl)prop-1-enyl]sulfonylurea |
|---|---|
| PubChem CID | 22750888 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1,1-diphenyl-3-[(E)-2-(4-propan-2-ylphenyl)prop-1-enyl]sulfonylurea |
| SMILES | C/C(=C\S(=O)(=O)NC(=O)N(c1ccccc1)c1ccccc1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-19(2)21-14-16-22(17-15-21)20(3)18-31(29,30)26-25(28)27(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-19H,1-3H3,(H,26,28)/b20-18+ |
| InChIKey | PGKFOWSIXWDRQR-CZIZESTLSA-N |
| XLogP | 6.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |