C11H11F3OS — CID 22752168
4-benzylsulfanyl-1,1,1-trifluorobutan-2-one (PubChem CID 22752168) has the molecular formula C11H11F3OS and a molecular weight of 248.27 g/mol. Its IUPAC name is 4-benzylsulfanyl-1,1,1-trifluorobutan-2-one.
| Compound Name | 4-benzylsulfanyl-1,1,1-trifluorobutan-2-one |
|---|---|
| PubChem CID | 22752168 |
| Molecular Formula | C11H11F3OS |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 4-benzylsulfanyl-1,1,1-trifluorobutan-2-one |
| SMILES | O=C(CCSCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3OS/c12-11(13,14)10(15)6-7-16-8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | KDWMVGJUVZRTNY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|