C11H11F5S — CID 13459532
3,3,4,4,4-pentafluorobutylsulfanylmethylbenzene (PubChem CID 13459532) has the molecular formula C11H11F5S and a molecular weight of 270.27 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutylsulfanylmethylbenzene.
| Compound Name | 3,3,4,4,4-pentafluorobutylsulfanylmethylbenzene |
|---|---|
| PubChem CID | 13459532 |
| Molecular Formula | C11H11F5S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutylsulfanylmethylbenzene |
| SMILES | FC(F)(F)C(F)(F)CCSCc1ccccc1 |
| InChI | InChI=1S/C11H11F5S/c12-10(13,11(14,15)16)6-7-17-8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | UTCKVMTWVCOGPA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|