C25H22O4S — CID 22753275
(4-hydroxyphenyl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxo-1-benzothiophen-3-yl]methanone (PubChem CID 22753275) has the molecular formula C25H22O4S and a molecular weight of 418.51 g/mol. Its IUPAC name is (4-hydroxyphenyl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxo-1-benzothiophen-3-yl]methanone.
| Compound Name | (4-hydroxyphenyl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxo-1-benzothiophen-3-yl]methanone |
|---|---|
| PubChem CID | 22753275 |
| Molecular Formula | C25H22O4S |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (4-hydroxyphenyl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxo-1-benzothiophen-3-yl]methanone |
| SMILES | CC(C)(C)Oc1ccc(C2=C(C(=O)c3ccc(O)cc3)c3ccccc3S2=O)cc1 |
| InChI | InChI=1S/C25H22O4S/c1-25(2,3)29-19-14-10-17(11-15-19)24-22(20-6-4-5-7-21(20)30(24)28)23(27)16-8-12-18(26)13-9-16/h4-15,26H,1-3H3 |
| InChIKey | WLJMWHKMVOJJLK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|