2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid

C5H10N2O4S — CID 22756045

IUPAC2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid
SMILESC=CC1=NCCN1.O=S(=O)(O)O
InChIInChI=1S/C5H8N2.H2O4S/c1-2-5-6-3-4-7-5;1-5(2,3)4/h2H,1,3-4H2,(H,6,7);(H2,1,2,3,4)
InChIKeyZKECLWNBBZPOFW-UHFFFAOYSA-N
MW194.21 g/mol
LogP-0.48
Rot. Bonds1

About 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid

2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid (PubChem CID 22756045) has the molecular formula C5H10N2O4S and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid.

Molecular Properties

Compound Name2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid
PubChem CID22756045
Molecular FormulaC5H10N2O4S
Molecular Weight194.21 g/mol
Exact Mass194.04
IUPAC Name2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid
SMILESC=CC1=NCCN1.O=S(=O)(O)O
InChIInChI=1S/C5H8N2.H2O4S/c1-2-5-6-3-4-7-5;1-5(2,3)4/h2H,1,3-4H2,(H,6,7);(H2,1,2,3,4)
InChIKeyZKECLWNBBZPOFW-UHFFFAOYSA-N
XLogP-0.48
TPSA98.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.21
LogP ≤ 5-0.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid?
The IUPAC name of 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid (CID 22756045) is 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid.
What is the SMILES notation for 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid?
The canonical SMILES for 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid is C=CC1=NCCN1.O=S(=O)(O)O.
What is the InChIKey of 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid?
The InChIKey is ZKECLWNBBZPOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.H2O4S/c1-2-5-6-3-4-7-5;1-5(2,3)4/h2H,1,3-4H2,(H,6,7);(H2,1,2,3,4).
What are the key properties of 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid?
2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid has a molecular weight of 194.21 g/mol, XLogP of -0.48, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4,5-dihydro-1H-imidazole;sulfuric acid is sourced from PubChem (CID 22756045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).