C13H18N2 — CID 145111206
ethane;2-[(E)-2-phenylethenyl]-4,5-dihydro-1H-imidazole (PubChem CID 145111206) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is ethane;2-[(E)-2-phenylethenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | ethane;2-[(E)-2-phenylethenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 145111206 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | ethane;2-[(E)-2-phenylethenyl]-4,5-dihydro-1H-imidazole |
| SMILES | C(=C/c1ccccc1)\C1=NCCN1.CC |
| InChI | InChI=1S/C11H12N2.C2H6/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11;1-2/h1-7H,8-9H2,(H,12,13);1-2H3/b7-6+; |
| InChIKey | LGIFFLYZVZZQIT-UHDJGPCESA-N |
| XLogP | 2.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |